| Compound Information | SONAR Target prediction | | Name: | Idarubicin | | Unique Identifier: | LOPAC 00975 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26H27NO9 | | Molecular Weight: | 471.287 g/mol | | X log p: | 4.988 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 69.67 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC1OC(CC(N)C1O)OC1CC(O)(Cc2c(O)c3c(=O)c4ccccc4c(=O)c3c(O)c12)C(C)=O | | Class: | DNA Metabolism | | Action: | Inhibitor |
| Species: |
4932 |
| Condition: |
LGE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.0464±0.000353553 |
| Normalized OD Score: sc h |
0.0958±0.00146265 |
| Z-Score: |
-31.0333±0.857415 |
| p-Value: |
0 |
| Z-Factor: |
0.891833 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|D11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.00 Celcius | | Date: | 2005-11-29 YYYY-MM-DD | | Plate CH Control (+): | 0.039675±0.00225 | | Plate DMSO Control (-): | 0.5167±0.01618 | | Plate Z-Factor: | 0.8976 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 42890 |
(7S,9S)-9-acetyl-7-[(2S,4S,5S,6S)-4-amino-5-hydroxy-6-methyl-oxan-2-yl]oxy-6,9,11-trihydroxy-8,10-dihydr o-7H-tetracene-5,12-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5481 | Additional Members: 8 | Rows returned: 5 | |
|