Compound Information | SONAR Target prediction | Name: | 5-hydroxydecanoic acid sodium | Unique Identifier: | LOPAC 00965 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H19NaO3 | Molecular Weight: | 191.095 g/mol | X log p: | -1.325 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.13 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 8 | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | Class: | K+ Channel | Action: | Blocker |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.6972±0.0205768 |
Normalized OD Score: sc h |
0.9872±0.0216513 |
Z-Score: |
-0.5889±0.992016 |
p-Value: |
0.55365 |
Z-Factor: |
-20.6191 |
Fitness Defect: |
0.5912 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.60 Celcius | Date: | 2005-04-15 YYYY-MM-DD | Plate CH Control (+): | 0.044550000000000006±0.00331 | Plate DMSO Control (-): | 0.668±0.05903 | Plate Z-Factor: | 0.8797 |
| png ps pdf |
5284157 |
(4R)-4-[(3R,5S,7R,8R,9S,10R,13S,14S,17S)-3,7,17-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15, 16-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5284161 |
(4R)-4-[(3R,5S,7S,8R,9S,10R,13S,14S,17S)-3,7,17-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15, 16-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5284217 |
(6S)-5-hydroxy-2-methyl-6-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5 ,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
5284222 |
(6R)-6-[(5R,7S,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-heptanoic acid |
5284223 |
(6R)-6-[(5R,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-heptanoic acid |
5284224 |
(6R)-6-[(5S,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-heptanoic acid |
internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|