| Compound Information | SONAR Target prediction | | Name: | 5-hydroxydecanoic acid sodium | | Unique Identifier: | LOPAC 00965 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H19NaO3 | | Molecular Weight: | 191.095 g/mol | | X log p: | -1.325 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.13 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | | Class: | K+ Channel | | Action: | Blocker |
| Species: |
4932 |
| Condition: |
WHI3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7149±0.0719835 |
| Normalized OD Score: sc h |
1.0516±0.07877 |
| Z-Score: |
1.6061±2.54363 |
| p-Value: |
0.424016 |
| Z-Factor: |
-5.18677 |
| Fitness Defect: |
0.858 |
| Bioactivity Statement: |
Outlier |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|G9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-20 YYYY-MM-DD | | Plate CH Control (+): | 0.044625±0.00104 | | Plate DMSO Control (-): | 0.66255±0.04593 | | Plate Z-Factor: | 0.8870 |
| png ps pdf |
| 5283949 |
(4R)-4-[(3R,5R,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 5283950 |
(4R)-4-[(3S,5R,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 5283951 |
(4R)-4-[(3S,5R,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 5283956 |
(4R)-4-[(5R,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 5283957 |
(4R)-4-[(5S,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 5284002 |
(4R)-4-[(3R,5S,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-hydroxy-pentanoic acid |
| internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
| active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|