Compound Information | SONAR Target prediction | Name: | 5-hydroxydecanoic acid sodium | Unique Identifier: | LOPAC 00965 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H19NaO3 | Molecular Weight: | 191.095 g/mol | X log p: | -1.325 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.13 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 8 | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | Class: | K+ Channel | Action: | Blocker |
Species: |
4932 |
Condition: |
NUM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7534±0.0382545 |
Normalized OD Score: sc h |
1.0282±0.0346142 |
Z-Score: |
1.6336±1.95984 |
p-Value: |
0.403416 |
Z-Factor: |
-3.91962 |
Fitness Defect: |
0.9078 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-11-30 YYYY-MM-DD | Plate CH Control (+): | 0.03925±0.00110 | Plate DMSO Control (-): | 0.769975±0.02725 | Plate Z-Factor: | 0.9542 |
| png ps pdf |
5283949 |
(4R)-4-[(3R,5R,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5283950 |
(4R)-4-[(3S,5R,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5283951 |
(4R)-4-[(3S,5R,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5283956 |
(4R)-4-[(5R,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5283957 |
(4R)-4-[(5S,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
5284002 |
(4R)-4-[(3R,5S,7S,8S,9S,10R,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-hydroxy-pentanoic acid |
active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|