| Compound Information | SONAR Target prediction | | Name: | 5-hydroxydecanoic acid sodium | | Unique Identifier: | LOPAC 00965 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H19NaO3 | | Molecular Weight: | 191.095 g/mol | | X log p: | -1.325 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.13 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | | Class: | K+ Channel | | Action: | Blocker |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.7737±0.0530596 |
| Normalized OD Score: sc h |
1.0222±0.0193696 |
| Z-Score: |
0.6873±0.758935 |
| p-Value: |
0.386384 |
| Z-Factor: |
-4.7476 |
| Fitness Defect: |
0.9509 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|G9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.046637500000000005±0.00115 | | Plate DMSO Control (-): | 0.7662749999999999±0.04402 | | Plate Z-Factor: | 0.9298 |
| png ps pdf |
| 3060305 |
2-[1-(2-hydroxyethyl)cyclohexyl]acetic acid |
| 3246580 |
2-[(5R,7R)-3-hydroxy-1-adamantyl]acetic acid |
| 3535798 |
2-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenan thren-17-yl)propanoic acid |
| 4046638 |
4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phen anthren-17-yl)pentanoic acid |
| 4552537 |
4-hydroxyadamantane-1-carboxylic acid |
| 5091283 |
2-(3-hydroxy-1-adamantyl)acetate |
| internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
| nonactive | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|