| Compound Information | SONAR Target prediction | | Name: | 5-hydroxydecanoic acid sodium | | Unique Identifier: | LOPAC 00965 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H19NaO3 | | Molecular Weight: | 191.095 g/mol | | X log p: | -1.325 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.13 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | | Class: | K+ Channel | | Action: | Blocker |
| Species: |
4932 |
| Condition: |
CLN3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6531±0.0473054 |
| Normalized OD Score: sc h |
1.0223±0.0550834 |
| Z-Score: |
0.6193±1.79053 |
| p-Value: |
0.288566 |
| Z-Factor: |
-5.74648 |
| Fitness Defect: |
1.2428 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|G9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.90 Celcius | | Date: | 2005-05-08 YYYY-MM-DD | | Plate CH Control (+): | 0.045425±0.00296 | | Plate DMSO Control (-): | 0.62435±0.06906 | | Plate Z-Factor: | 0.7014 |
|  png
ps
pdf |
| 713509 |
2-[(5R,7S)-3-hydroxy-1-adamantyl]acetic acid |
| 915383 |
(3S,5R)-4-hydroxyadamantane-1-carboxylic acid |
| 2303780 |
2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate |
| 2754275 |
(4S)-4-[(3R,5S,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetr
adecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 2802922 |
2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid |
| 3060304 |
sodium 2-[1-(2-hydroxyethyl)cyclohexyl]acetate |
| internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
| active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|
