Compound Information | SONAR Target prediction | Name: | 5-hydroxydecanoic acid sodium | Unique Identifier: | LOPAC 00965 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H19NaO3 | Molecular Weight: | 191.095 g/mol | X log p: | -1.325 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.13 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 8 | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | Class: | K+ Channel | Action: | Blocker |
Species: |
4932 |
Condition: |
tep1-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.7970±0.0814587 |
Normalized OD Score: sc h |
1.0439±0.0262738 |
Z-Score: |
1.6720±1.01619 |
p-Value: |
0.178579 |
Z-Factor: |
-2.6868 |
Fitness Defect: |
1.7227 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-07-07 YYYY-MM-DD | Plate CH Control (+): | 0.044274999999999995±0.00219 | Plate DMSO Control (-): | 0.7455±0.03202 | Plate Z-Factor: | 0.8997 |
| png ps pdf |
713509 |
2-[(5R,7S)-3-hydroxy-1-adamantyl]acetic acid |
915383 |
(3S,5R)-4-hydroxyadamantane-1-carboxylic acid |
2303780 |
2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate |
2754275 |
(4S)-4-[(3R,5S,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetr adecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
2802922 |
2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid |
3060304 |
sodium 2-[1-(2-hydroxyethyl)cyclohexyl]acetate |
internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|