| Compound Information | SONAR Target prediction | | Name: | 5-hydroxydecanoic acid sodium | | Unique Identifier: | LOPAC 00965 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H19NaO3 | | Molecular Weight: | 191.095 g/mol | | X log p: | -1.325 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.13 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | | Class: | K+ Channel | | Action: | Blocker |
| Species: |
4932 |
| Condition: |
MT2481-pdr1pdr3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6790±0.0113137 |
| Normalized OD Score: sc h |
1.0248±0.00949921 |
| Z-Score: |
1.3813±0.44072 |
| p-Value: |
0.18762 |
| Z-Factor: |
-2.17345 |
| Fitness Defect: |
1.6733 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|G9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-08 YYYY-MM-DD | | Plate CH Control (+): | 0.04555±0.00109 | | Plate DMSO Control (-): | 0.651025±0.01278 | | Plate Z-Factor: | 0.9304 |
|  png
ps
pdf |
| 429307 |
2-(3-hydroxy-1-adamantyl)acetic acid |
| 439472 |
4-[(3R,5S,7R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclope
nta[a]phenanthren-17-yl]pentanoic acid |
| 448643 |
2-[(1S,3S,4R)-4-hydroxy-2,2,3-trimethyl-cyclopentyl]acetic acid |
| 495540 |
4-(3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phena
nthren-17-yl)-2-methyl-pentanoic acid |
| 500164 |
4-(3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phena
nthren-17-yl)pentanoic acid |
| 548046 |
3-(2-hydroxy-2-methyl-propyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid |
| internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
| active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|
