| Compound Information | SONAR Target prediction | | Name: | 5-hydroxydecanoic acid sodium | | Unique Identifier: | LOPAC 00965 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H19NaO3 | | Molecular Weight: | 191.095 g/mol | | X log p: | -1.325 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.13 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | | Class: | K+ Channel | | Action: | Blocker |
| Species: |
4932 |
| Condition: |
GAS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6834±0.0259508 |
| Normalized OD Score: sc h |
0.9996±0.014587 |
| Z-Score: |
-0.0218±0.699547 |
| p-Value: |
0.620926 |
| Z-Factor: |
-10.0251 |
| Fitness Defect: |
0.4765 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|G9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.30 Celcius | | Date: | 2005-11-17 YYYY-MM-DD | | Plate CH Control (+): | 0.042300000000000004±0.00209 | | Plate DMSO Control (-): | 0.668275±0.01567 | | Plate Z-Factor: | 0.9552 |
| png ps pdf |
| 151138 |
4-hydroxycyclohexane-1-carboxylic acid |
| 158005 |
(4R)-4-[(3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 159655 |
(4R)-4-[(5R,7R,8R,9S,10S,12S,13R,14S,17S)-7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 187922 |
2-ethyl-5-hydroxy-hexanoic acid |
| 376834 |
4-[(5S,7S,8R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradeca hydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| 376835 |
4-[(5S,7S,8R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradeca hydrocyclopenta[a]phenanthren-17-yl]-2-methyl-pentanoic acid |
| internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
| active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|