Compound Information | SONAR Target prediction | Name: | 5-hydroxydecanoic acid sodium | Unique Identifier: | LOPAC 00965 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H19NaO3 | Molecular Weight: | 191.095 g/mol | X log p: | -1.325 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.13 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 8 | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | Class: | K+ Channel | Action: | Blocker |
Species: |
4932 |
Condition: |
KRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6640±0.0207182 |
Normalized OD Score: sc h |
1.0134±0.00159305 |
Z-Score: |
0.5709±0.0475363 |
p-Value: |
0.568258 |
Z-Factor: |
-2.20491 |
Fitness Defect: |
0.5652 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.90 Celcius | Date: | 2005-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.038925±0.00176 | Plate DMSO Control (-): | 0.655825±0.00877 | Plate Z-Factor: | 0.9516 |
| png ps pdf |
7162268 |
(1S,2R,5S,6R)-2-hydroxybicyclo[3.2.1]octane-6-carboxylate |
7162269 |
(1S,2R,5S,6R)-2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid |
7173468 |
(4S)-4-[(3R,5S,7R,8R,9R,10S,13R,14R,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
7173469 |
(4S)-4-[(3R,5S,7R,8R,9R,10S,13R,14R,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
7173470 |
(4S)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
7173471 |
(4S)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|