Compound Information | SONAR Target prediction | Name: | 5-hydroxydecanoic acid sodium | Unique Identifier: | LOPAC 00965 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H19NaO3 | Molecular Weight: | 191.095 g/mol | X log p: | -1.325 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.13 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 8 | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | Class: | K+ Channel | Action: | Blocker |
Species: |
4932 |
Condition: |
HOC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6132±0.0151321 |
Normalized OD Score: sc h |
1.0174±0.00643377 |
Z-Score: |
0.8154±0.3684 |
p-Value: |
0.430492 |
Z-Factor: |
-4.61128 |
Fitness Defect: |
0.8428 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2005-11-24 YYYY-MM-DD | Plate CH Control (+): | 0.0393±0.00118 | Plate DMSO Control (-): | 0.597325±0.01238 | Plate Z-Factor: | 0.9367 |
| png ps pdf |
6954334 |
(3R,5R)-4-hydroxyadamantane-1-carboxylate |
6954335 |
(3R,5R)-4-hydroxyadamantane-1-carboxylic acid |
7098618 |
(4S)-4-[(3R,5S,7R,8R,9R,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
7098619 |
(4S)-4-[(3R,5S,7R,8R,9R,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
7158375 |
(4S)-4-[(3S,5R,7R,8R,9R,10S,13R,14S,17S)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
7158376 |
(4S)-4-[(3S,5R,7R,8R,9R,10S,13R,14S,17S)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|