Compound Information | SONAR Target prediction | Name: | 5-hydroxydecanoic acid sodium | Unique Identifier: | LOPAC 00965 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H19NaO3 | Molecular Weight: | 191.095 g/mol | X log p: | -1.325 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.13 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 8 | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | Class: | K+ Channel | Action: | Blocker |
Species: |
4932 |
Condition: |
GAS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6834±0.0259508 |
Normalized OD Score: sc h |
0.9996±0.014587 |
Z-Score: |
-0.0218±0.699547 |
p-Value: |
0.620926 |
Z-Factor: |
-10.0251 |
Fitness Defect: |
0.4765 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.30 Celcius | Date: | 2005-11-17 YYYY-MM-DD | Plate CH Control (+): | 0.042300000000000004±0.00209 | Plate DMSO Control (-): | 0.668275±0.01567 | Plate Z-Factor: | 0.9552 |
| png ps pdf |
6954334 |
(3R,5R)-4-hydroxyadamantane-1-carboxylate |
6954335 |
(3R,5R)-4-hydroxyadamantane-1-carboxylic acid |
7098618 |
(4S)-4-[(3R,5S,7R,8R,9R,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
7098619 |
(4S)-4-[(3R,5S,7R,8R,9R,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
7158375 |
(4S)-4-[(3S,5R,7R,8R,9R,10S,13R,14S,17S)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
7158376 |
(4S)-4-[(3S,5R,7R,8R,9R,10S,13R,14S,17S)-3,7-dihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15, 16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|