| Compound Information | SONAR Target prediction | | Name: | 5-hydroxydecanoic acid sodium | | Unique Identifier: | LOPAC 00965 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H19NaO3 | | Molecular Weight: | 191.095 g/mol | | X log p: | -1.325 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.13 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | | Class: | K+ Channel | | Action: | Blocker |
| Species: |
4932 |
| Condition: |
BY4743 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7792±0.166382 |
| Normalized OD Score: sc h |
1.0117±0.0325534 |
| Z-Score: |
0.3018±0.877842 |
| p-Value: |
0.553018 |
| Z-Factor: |
-8.67382 |
| Fitness Defect: |
0.5924 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|G9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-19 YYYY-MM-DD | | Plate CH Control (+): | 0.04625±0.00269 | | Plate DMSO Control (-): | 0.738375±0.02406 | | Plate Z-Factor: | 0.9155 |
| png ps pdf |
| 6925925 |
2-[(5S,7S)-3-hydroxy-1-adamantyl]acetic acid |
| 6925926 |
2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate |
| 6928771 |
(1S,2S,5S,6R)-2-hydroxybicyclo[3.2.1]octane-6-carboxylate |
| 6928772 |
(1S,2S,5S,6R)-2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid |
| 6954332 |
(3S,5S)-4-hydroxyadamantane-1-carboxylate |
| 6954333 |
(3S,5S)-4-hydroxyadamantane-1-carboxylic acid |
| internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
| active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|