Compound Information | SONAR Target prediction | Name: | 5-hydroxydecanoic acid sodium | Unique Identifier: | LOPAC 00965 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H19NaO3 | Molecular Weight: | 191.095 g/mol | X log p: | -1.325 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.13 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 8 | Canonical Smiles: | [Na+].[O-]C(=O)CCCC(O)CCCCC | Class: | K+ Channel | Action: | Blocker |
Species: |
4932 |
Condition: |
LGE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5277±0.0306177 |
Normalized OD Score: sc h |
1.0264±0.0241902 |
Z-Score: |
0.9185±0.856811 |
p-Value: |
0.440966 |
Z-Factor: |
-4.29388 |
Fitness Defect: |
0.8188 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.00 Celcius | Date: | 2005-11-29 YYYY-MM-DD | Plate CH Control (+): | 0.039675±0.00225 | Plate DMSO Control (-): | 0.5167±0.01618 | Plate Z-Factor: | 0.8976 |
| png ps pdf |
6925925 |
2-[(5S,7S)-3-hydroxy-1-adamantyl]acetic acid |
6925926 |
2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate |
6928771 |
(1S,2S,5S,6R)-2-hydroxybicyclo[3.2.1]octane-6-carboxylate |
6928772 |
(1S,2S,5S,6R)-2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid |
6954332 |
(3S,5S)-4-hydroxyadamantane-1-carboxylate |
6954333 |
(3S,5S)-4-hydroxyadamantane-1-carboxylic acid |
internal high similarity DBLink | Rows returned: 14 | 1 2 3 Next >> |
active | Cluster 12601 | Additional Members: 1 | Rows returned: 0 | |
|