| Compound Information | SONAR Target prediction | | Name: | Retinoic acid p-hydroxyanilide | | Unique Identifier: | LOPAC 00957 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26H33NO2 | | Molecular Weight: | 358.284 g/mol | | X log p: | 20.884 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC1CCCC(C)(C)C=1C=CC(C)=CC=CC(C)=CC(=O)Nc1ccc(O)cc1 | | Class: | Cell Cycle | | Action: | Inhibitor | | Generic_name: | N-(4-HYDROXYPHENYL)ALL-TRANS RETINAMIDE | | Chemical_iupac_name: | N-(4-HYDROXYPHENYL)ALL-TRANS RETINAMIDE | | Drug_type: | Experimental | | Drugbank_id: | EXPT01420 | | Logp: | 5.99 | | Drug_category: | Retinol Binding Protein Complexed With Fenre inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
LGE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5350±0.0366988 |
| Normalized OD Score: sc h |
0.9987±0.000381946 |
| Z-Score: |
-0.0448±0.0117952 |
| p-Value: |
0.964298 |
| Z-Factor: |
-25.5808 |
| Fitness Defect: |
0.0364 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|G6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.00 Celcius | | Date: | 2005-11-29 YYYY-MM-DD | | Plate CH Control (+): | 0.039675±0.00225 | | Plate DMSO Control (-): | 0.5167±0.01618 | | Plate Z-Factor: | 0.8976 |
| png ps pdf |
| DBLink | Rows returned: 4 | |
| 1744 |
N-(4-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenamide |
| 5288209 |
(2Z,4E,6Z,8E)-N-(4-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenami de |
| 6440160 |
(2Z,4E,6Z,8E)-N-(4-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenami de |
| 6603872 |
(2Z,4E,6Z,8E)-N-(4-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenami de |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 820 | Additional Members: 15 | Rows returned: 3 | |
|