| Compound Information | SONAR Target prediction |
| Name: | 17alpha-hydroxyprogesterone |
| Unique Identifier: | LOPAC 00951 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C21H30O3 |
| Molecular Weight: | 303.247 g/mol |
| X log p: | 0.673 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 34.14 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | CC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
| Class: | Hormone |
| Action: | Metabolite |
| Selectivity: | Progesterone |
| Generic_name: | Medroxyprogesterone |
| Chemical_iupac_name: | 17-acetyl-17-hydroxy-6,10,13-trimethyl-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradeca hydrocyclopenta[a]phenanthren-3-one |
| Drug_type: | Approved Drug |
| Kegg_compound_id: | C07119 |
| Drugbank_id: | APRD00627 |
| Melting_point: | 220 - 223.5 oC |
| H2o_solubility: | 22.2mg/L |
| Logp: | 3.606 |
| Cas_registry_number: | 520-85-4 |
| Drug_category: | Contraceptives; Progestins; ATC:G03AC06; ATC:G03DA02; ATC:L02AB02 |
| Indication: | Contraception |
| Pharmacology: | Medroxyprogesterone, a synthetic progestin more potent than progesterone, is used as a contraceptive and to treat amenorrhea, abnormal uterine bleeding, endometriosis, endometrial and renal cell carcinomas, and pulmonary disorders such as chronic obstructive pulmonary disease (COPD), Pickwickian syndrome, and other hypercapnic pulmonary conditions. |
| Mechanism_of_action: | Progestins diffuse freely into target cells in the female reproductive tract, mammary gland, hypothalamus, and the pituitary and bind to the progesterone receptor. Once bound to the receptor, progestins slow the frequency of release of gonadotropin releasing hormone (GnRH) from the hypothalamus and blunt the pre-ovulatory LH surge. |
| Organisms_affected: | Humans and other mammals |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [24] |
| Species: | 4932 |
| Condition: | MRC1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8281±0.0109602 |
| Normalized OD Score: sc h | 0.9846±0.00468949 |
| Z-Score: | -1.1061±0.236323 |
| p-Value: | 0.275358 |
| Z-Factor: | -2.97703 |
| Fitness Defect: | 1.2897 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 58 | << Back 1 2 3 4 5 6 7 8 9 10 Next >> |
| 628960 | 17-acetyl-17-hydroxy-13-methyl-4,5,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| 667489 | (6R,8R,9R,10R,13S,14S,17S)-17-acetyl-17-hydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H- cyclopenta[a]phenanthren-3-one |
| 928565 | (8S,9R,10R,13S,14R,17S)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclop enta[a]phenanthren-3-one |
| 1775452 | (6R,8R,9S,10R,13S,14R,17S)-17-acetyl-17-hydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H- cyclopenta[a]phenanthren-3-one |
| 1775453 | (6R,8R,9R,10R,13S,14R,17S)-17-acetyl-17-hydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H- cyclopenta[a]phenanthren-3-one |
| 1775455 | (6R,8R,9S,10R,13S,14S,17S)-17-acetyl-17-hydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H- cyclopenta[a]phenanthren-3-one |
| internal high similarity DBLink | Rows returned: 15 | 1 2 3 Next >> |
| SPE01500990 | 0.9167 |
| SPE01500989 | 0.9167 |
| LOPAC 00661 | 0.9184 |
| LOPAC 00759 | 0.9184 |
| SB 01709 | 0.9556 |
| NRB 04205 | 0.9556 |
| active | Cluster 13537 | Additional Members: 14 | Rows returned: 4 |
| SPE01500343 | 0.421052631578947 |
| LOPAC 00859 | 0.375 |
| SPE01503221 | 0.353846153846154 |
| SPE01701060 | 0 |
Service provided by the
Mike Tyers Laboratory