| Compound Information | SONAR Target prediction | | Name: | Hydrocortisone 21-hemisuccinate sodium | | Unique Identifier: | LOPAC 00944 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C25H33NaO8 | | Molecular Weight: | 454.276 g/mol | | X log p: | -1.279 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 100.57 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | [Na+].[O-]C(=O)CCC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C | | Class: | Hormone | | Selectivity: | Cortisol |
| Species: |
4932 |
| Condition: |
ESC2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5588±0.0359917 |
| Normalized OD Score: sc h |
1.0050±0.00204975 |
| Z-Score: |
0.1566±0.0736786 |
| p-Value: |
0.875724 |
| Z-Factor: |
-6.09671 |
| Fitness Defect: |
0.1327 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 8|G4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 28.20 Celcius | | Date: | 2005-11-25 YYYY-MM-DD | | Plate CH Control (+): | 0.04005±0.00510 | | Plate DMSO Control (-): | 0.54505±0.01310 | | Plate Z-Factor: | 0.9130 |
|  png
ps
pdf |
| 7060957 |
4-[2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr
o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
| 7060958 |
4-[2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr
o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
| 7060959 |
4-[2-[(8R,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr
o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
| 7060960 |
4-[2-[(8R,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr
o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
| 16051983 |
sodium
4-[[(8R,9R,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,
15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxo-butanoate |
| 16051984 |
4-[[(8R,9R,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,
15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxo-butanoic acid |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|
