Compound Information | SONAR Target prediction | Name: | Hydrocortisone 21-hemisuccinate sodium | Unique Identifier: | LOPAC 00944 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C25H33NaO8 | Molecular Weight: | 454.276 g/mol | X log p: | -1.279 (online calculus) | Lipinksi Failures | 0 | TPSA | 100.57 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 7 | Canonical Smiles: | [Na+].[O-]C(=O)CCC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C | Class: | Hormone | Selectivity: | Cortisol |
Species: |
4932 |
Condition: |
LGE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5398±0.0377595 |
Normalized OD Score: sc h |
1.0099±0.00951618 |
Z-Score: |
0.3349±0.316698 |
p-Value: |
0.743936 |
Z-Factor: |
-7.23601 |
Fitness Defect: |
0.2958 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|G4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.00 Celcius | Date: | 2005-11-29 YYYY-MM-DD | Plate CH Control (+): | 0.039675±0.00225 | Plate DMSO Control (-): | 0.5167±0.01618 | Plate Z-Factor: | 0.8976 |
| png ps pdf |
1778039 |
4-[2-[(8R,9S,10S,11R,13S,14R,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoate |
1778040 |
4-[2-[(8R,9S,10S,11R,13S,14R,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydr o-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
4636604 |
4-[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthre n-17-yl)-2-oxo-ethoxy]-4-oxo-butanoate |
5702069 |
4-[2-[(10R,11S,13S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclo penta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
6326361 |
4-[2-[(8S,10R,11S,13S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclop enta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
6426639 |
4-[2-[(17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phen anthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|