Compound Information | SONAR Target prediction | Name: | N-(3,3-Diphenylpropyl)glycinamide | Unique Identifier: | LOPAC 00929 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H20N2O | Molecular Weight: | 248.195 g/mol | X log p: | 20.914 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 7 | Canonical Smiles: | NC(=O)CNCCC(c1ccccc1)c1ccccc1 | Class: | Glutamate | Action: | Blocker | Selectivity: | NMDA |
Species: |
4932 |
Condition: |
GAS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6543±0.0170413 |
Normalized OD Score: sc h |
0.9719±0.00612266 |
Z-Score: |
-1.3483±0.294532 |
p-Value: |
0.186935 |
Z-Factor: |
-1.67569 |
Fitness Defect: |
1.677 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 7|A10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.30 Celcius | Date: | 2005-11-17 YYYY-MM-DD | Plate CH Control (+): | 0.039575±0.00156 | Plate DMSO Control (-): | 0.6731499999999999±0.01603 | Plate Z-Factor: | 0.9256 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6603827 |
2-(3,3-diphenylpropylamino)acetamide |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 3400 | Additional Members: 5 | Rows returned: 3 | |
|