Compound Information | SONAR Target prediction | Name: | N-(3,3-Diphenylpropyl)glycinamide | Unique Identifier: | LOPAC 00929 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H20N2O | Molecular Weight: | 248.195 g/mol | X log p: | 20.914 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 7 | Canonical Smiles: | NC(=O)CNCCC(c1ccccc1)c1ccccc1 | Class: | Glutamate | Action: | Blocker | Selectivity: | NMDA |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.6955±0.00940452 |
Normalized OD Score: sc h |
0.9934±0.0145952 |
Z-Score: |
-0.2938±0.659955 |
p-Value: |
0.654876 |
Z-Factor: |
-31.5908 |
Fitness Defect: |
0.4233 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 7|A10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.60 Celcius | Date: | 2005-04-15 YYYY-MM-DD | Plate CH Control (+): | 0.044599999999999994±0.00168 | Plate DMSO Control (-): | 0.66195±0.02552 | Plate Z-Factor: | 0.8567 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6603827 |
2-(3,3-diphenylpropylamino)acetamide |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 3400 | Additional Members: 5 | Rows returned: 3 | |
|