| Compound Information | SONAR Target prediction | | Name: | N-(3,3-Diphenylpropyl)glycinamide | | Unique Identifier: | LOPAC 00929 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H20N2O | | Molecular Weight: | 248.195 g/mol | | X log p: | 20.914 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | NC(=O)CNCCC(c1ccccc1)c1ccccc1 | | Class: | Glutamate | | Action: | Blocker | | Selectivity: | NMDA |
| Species: |
4932 |
| Condition: |
PAC10 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6955±0.00940452 |
| Normalized OD Score: sc h |
0.9934±0.0145952 |
| Z-Score: |
-0.2938±0.659955 |
| p-Value: |
0.654876 |
| Z-Factor: |
-31.5908 |
| Fitness Defect: |
0.4233 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 7|A10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.60 Celcius | | Date: | 2005-04-15 YYYY-MM-DD | | Plate CH Control (+): | 0.044599999999999994±0.00168 | | Plate DMSO Control (-): | 0.66195±0.02552 | | Plate Z-Factor: | 0.8567 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 6603827 |
2-(3,3-diphenylpropylamino)acetamide |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 3400 | Additional Members: 5 | Rows returned: 1 | |
|