Compound Information | SONAR Target prediction | Name: | 3-deazaadenosine | Unique Identifier: | LOPAC 00858 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H12N4O4 | Molecular Weight: | 240.132 g/mol | X log p: | 5.389 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 2 | Canonical Smiles: | OCC1OC(C(O)C1O)n1cnc2cncnc12 | Class: | Immune System | Action: | Inhibitor |
Species: |
4932 |
Condition: |
SQS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7491±0.0144957 |
Normalized OD Score: sc h |
1.0177±0.0046264 |
Z-Score: |
0.8615±0.0314701 |
p-Value: |
0.38908 |
Z-Factor: |
-2.75995 |
Fitness Defect: |
0.944 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 6|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-05-21 YYYY-MM-DD | Plate CH Control (+): | 0.04875±0.00135 | Plate DMSO Control (-): | 0.7337750000000001±0.02755 | Plate Z-Factor: | 0.8734 |
| png ps pdf |
68368 |
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
248425 |
2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
638281 |
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
6541016 |
(2R,3S,4S,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
6603825 |
(2S,3S,4S,5R)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
6713051 |
(2S,3S,4R,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 16028 | Additional Members: 4 | Rows returned: 3 | |
|