| Compound Information | SONAR Target prediction |  | Name: | 3-deazaadenosine |  | Unique Identifier: | LOPAC 00858  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C10H12N4O4 |  | Molecular Weight: | 240.132 g/mol |  | X log p: | 5.389  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 49.55 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | OCC1OC(C(O)C1O)n1cnc2cncnc12 |  | Class: | Immune System |  | Action: | Inhibitor |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BY4743 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8216±0.213405 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9876±0.00720055 | 
	 
	
		| Z-Score: | 
		-0.3455±0.212916 | 
	 
	
		| p-Value: | 
		0.732636 | 
	 
	
		| Z-Factor: | 
		-6.04373 | 
	 
	
		| Fitness Defect: | 
		0.3111 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 6|C4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2005-08-19 YYYY-MM-DD |  | Plate CH Control (+): | 0.046024999999999996±0.00128 |  | Plate DMSO Control (-): | 0.812075±0.02313 |  | Plate Z-Factor: | 0.9303 |  
  |  png ps pdf |  
 
 
	
		| 68368 | 
		(2R,3R,4R,5R)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol | 
	 
	
		| 248425 | 
		2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol | 
	 
	
		| 638281 | 
		(2R,3S,4R,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol | 
	 
	
		| 6541016 | 
		(2R,3S,4S,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol | 
	 
	
		| 6603825 | 
		(2S,3S,4S,5R)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol | 
	 
	
		| 6713051 | 
		(2S,3S,4R,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 16028 | Additional Members: 4 | Rows returned: 0 |  |  
  
 |