Compound Information | SONAR Target prediction | Name: | 3-deazaadenosine | Unique Identifier: | LOPAC 00858 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H12N4O4 | Molecular Weight: | 240.132 g/mol | X log p: | 5.389 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 2 | Canonical Smiles: | OCC1OC(C(O)C1O)n1cnc2cncnc12 | Class: | Immune System | Action: | Inhibitor |
Species: |
4932 |
Condition: |
SMI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6868±0.0185262 |
Normalized OD Score: sc h |
0.9566±0.0106725 |
Z-Score: |
-1.1776±0.197831 |
p-Value: |
0.24354 |
Z-Factor: |
-8.08662 |
Fitness Defect: |
1.4125 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 6|C4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2005-11-15 YYYY-MM-DD | Plate CH Control (+): | 0.038525000000000004±0.00122 | Plate DMSO Control (-): | 0.7283±0.03675 | Plate Z-Factor: | 0.8247 |
| png ps pdf |
68368 |
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
248425 |
2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
638281 |
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
6541016 |
(2R,3S,4S,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
6603825 |
(2S,3S,4S,5R)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
6713051 |
(2S,3S,4R,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 16028 | Additional Members: 4 | Rows returned: 3 | |
|