| Compound Information | SONAR Target prediction | | Name: | 3-deazaadenosine | | Unique Identifier: | LOPAC 00858 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H12N4O4 | | Molecular Weight: | 240.132 g/mol | | X log p: | 5.389 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 49.55 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | OCC1OC(C(O)C1O)n1cnc2cncnc12 | | Class: | Immune System | | Action: | Inhibitor |
| Species: |
4932 |
| Condition: |
WHI3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7552±0.109177 |
| Normalized OD Score: sc h |
1.0022±0.0119306 |
| Z-Score: |
0.1488±0.4891 |
| p-Value: |
0.732322 |
| Z-Factor: |
-7.65974 |
| Fitness Defect: |
0.3115 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 6|C4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-20 YYYY-MM-DD | | Plate CH Control (+): | 0.044425000000000006±0.00109 | | Plate DMSO Control (-): | 0.6967000000000001±0.03461 | | Plate Z-Factor: | 0.7639 |
| png ps pdf |
| 68368 |
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
| 248425 |
2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
| 638281 |
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
| 6541016 |
(2R,3S,4S,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
| 6603825 |
(2S,3S,4S,5R)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
| 6713051 |
(2S,3S,4R,5S)-2-(hydroxymethyl)-5-purin-9-yl-oxolane-3,4-diol |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 16028 | Additional Members: 4 | Rows returned: 0 | |
|