| Compound Information | SONAR Target prediction | | Name: | 3`,4`-Dichlorobenzamil | | Unique Identifier: | LOPAC 00857 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C13Cl4H13N7O | | Molecular Weight: | 411.996 g/mol | | X log p: | 5.411 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 41.79 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Cl.Nc1nc(N)c(nc1Cl)C(=O)NC(=N)NCc1ccc(Cl)c(Cl)c1 | | Class: | Ion Pump | | Action: | Inhibitor | | Selectivity: | Na+/Ca2+ exchanger |
| Species: |
4932 |
| Condition: |
HOC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5557±0.00883884 |
| Normalized OD Score: sc h |
0.9750±0.0108886 |
| Z-Score: |
-1.1738±0.605013 |
| p-Value: |
0.282464 |
| Z-Factor: |
-1.97392 |
| Fitness Defect: |
1.2642 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 6|B4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.60 Celcius | | Date: | 2005-11-24 YYYY-MM-DD | | Plate CH Control (+): | 0.039224999999999996±0.00138 | | Plate DMSO Control (-): | 0.5640000000000001±0.01473 | | Plate Z-Factor: | 0.8780 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
|
