| Compound Information | SONAR Target prediction | | Name: | 3`,4`-Dichlorobenzamil | | Unique Identifier: | LOPAC 00857 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C13Cl4H13N7O | | Molecular Weight: | 411.996 g/mol | | X log p: | 5.411 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 41.79 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Cl.Nc1nc(N)c(nc1Cl)C(=O)NC(=N)NCc1ccc(Cl)c(Cl)c1 | | Class: | Ion Pump | | Action: | Inhibitor | | Selectivity: | Na+/Ca2+ exchanger |
| Species: |
4932 |
| Condition: |
ESC2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4981±0.00678822 |
| Normalized OD Score: sc h |
0.9917±0.00723211 |
| Z-Score: |
-0.2509±0.208273 |
| p-Value: |
0.803984 |
| Z-Factor: |
-8.36575 |
| Fitness Defect: |
0.2182 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 6|B4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 28.20 Celcius | | Date: | 2005-11-25 YYYY-MM-DD | | Plate CH Control (+): | 0.039975±0.00183 | | Plate DMSO Control (-): | 0.5199750000000001±0.04036 | | Plate Z-Factor: | 0.8117 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 4060 | Additional Members: 8 | Rows returned: 2 | |
|
