| Compound Information | SONAR Target prediction | | Name: | 3`,4`-Dichlorobenzamil | | Unique Identifier: | LOPAC 00857 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C13Cl4H13N7O | | Molecular Weight: | 411.996 g/mol | | X log p: | 5.411 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 41.79 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Cl.Nc1nc(N)c(nc1Cl)C(=O)NC(=N)NCc1ccc(Cl)c(Cl)c1 | | Class: | Ion Pump | | Action: | Inhibitor | | Selectivity: | Na+/Ca2+ exchanger |
| Species: |
4932 |
| Condition: |
DEP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6006±0.0103945 |
| Normalized OD Score: sc h |
0.9803±0.0131779 |
| Z-Score: |
-0.7959±0.504943 |
| p-Value: |
0.454864 |
| Z-Factor: |
-6.72849 |
| Fitness Defect: |
0.7878 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 6|B4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2005-11-16 YYYY-MM-DD | | Plate CH Control (+): | 0.03925±0.00251 | | Plate DMSO Control (-): | 0.61035±0.01624 | | Plate Z-Factor: | 0.8973 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
|
