Compound Information | SONAR Target prediction | Name: | 3`,4`-Dichlorobenzamil | Unique Identifier: | LOPAC 00857 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C13Cl4H13N7O | Molecular Weight: | 411.996 g/mol | X log p: | 5.411 (online calculus) | Lipinksi Failures | 1 | TPSA | 41.79 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 6 | Canonical Smiles: | Cl.Nc1nc(N)c(nc1Cl)C(=O)NC(=N)NCc1ccc(Cl)c(Cl)c1 | Class: | Ion Pump | Action: | Inhibitor | Selectivity: | Na+/Ca2+ exchanger |
Species: |
4932 |
Condition: |
NOP13 |
Replicates: |
2 |
Raw OD Value: r im |
0.7182±0.0221324 |
Normalized OD Score: sc h |
1.0153±0.0187636 |
Z-Score: |
0.6599±0.780967 |
p-Value: |
0.569836 |
Z-Factor: |
-9.90209 |
Fitness Defect: |
0.5624 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 6|B4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-22 YYYY-MM-DD | Plate CH Control (+): | 0.047475±0.00082 | Plate DMSO Control (-): | 0.66325±0.02953 | Plate Z-Factor: | 0.8665 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 4060 | Additional Members: 8 | Rows returned: 2 | |
|