| Compound Information | SONAR Target prediction | | Name: | 3`,4`-Dichlorobenzamil | | Unique Identifier: | LOPAC 00857 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C13Cl4H13N7O | | Molecular Weight: | 411.996 g/mol | | X log p: | 5.411 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 41.79 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 8 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Cl.Nc1nc(N)c(nc1Cl)C(=O)NC(=N)NCc1ccc(Cl)c(Cl)c1 | | Class: | Ion Pump | | Action: | Inhibitor | | Selectivity: | Na+/Ca2+ exchanger |
| Species: |
4932 |
| Condition: |
MT2481-pdr1pdr3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6651±0.00176777 |
| Normalized OD Score: sc h |
1.0097±0.00970969 |
| Z-Score: |
0.5303±0.510123 |
| p-Value: |
0.61912 |
| Z-Factor: |
-5.69863 |
| Fitness Defect: |
0.4795 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 6|B4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-08 YYYY-MM-DD | | Plate CH Control (+): | 0.04605±0.00127 | | Plate DMSO Control (-): | 0.647725±0.01234 | | Plate Z-Factor: | 0.9304 |
| png ps pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
|