Compound Information | SONAR Target prediction | Name: | L-3,4-Dihydroxyphenylalanine methyl ester hydrochloride | Unique Identifier: | LOPAC 00822 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10ClH14NO4 | Molecular Weight: | 233.564 g/mol | X log p: | 6.221 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | Cl.COC(=O)C(N)Cc1ccc(O)c(O)c1 | Class: | Dopamine | Action: | Precursor |
Species: |
4932 |
Condition: |
ESC2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5075±0.0212132 |
Normalized OD Score: sc h |
1.0011±0.00142536 |
Z-Score: |
0.0344±0.0464444 |
p-Value: |
0.972546 |
Z-Factor: |
-6.88805 |
Fitness Defect: |
0.0278 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 5|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 28.20 Celcius | Date: | 2005-11-25 YYYY-MM-DD | Plate CH Control (+): | 0.039675±0.00158 | Plate DMSO Control (-): | 0.527025±0.02430 | Plate Z-Factor: | 0.8771 |
| png ps pdf |
23497 |
methyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
28934 |
methyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methyl-propanoate |
135504 |
methyl (2R)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
424631 |
methyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate |
5233030 |
[2-(3,4-dihydroxyphenyl)-1-methoxycarbonyl-ethyl]azanium |
6918946 |
[(1S)-2-(3,4-dihydroxyphenyl)-1-methoxycarbonyl-ethyl]azanium |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 12980 | Additional Members: 10 | Rows returned: 2 | |
|