| Compound Information | SONAR Target prediction | | Name: | Cantharidin | | Unique Identifier: | LOPAC 00793 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H12O4 | | Molecular Weight: | 184.105 g/mol | | X log p: | -1.539 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 52.6 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC12C3CCC(O3)C1(C)C(=O)OC2=O | | Class: | Phosphorylation | | Action: | Inhibitor | | Selectivity: | PP2A |
| Species: |
4932 |
| Condition: |
SQS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6552±0.0101116 |
| Normalized OD Score: sc h |
0.9114±0.00246994 |
| Z-Score: |
-4.4557±1.12668 |
| p-Value: |
0.000126671 |
| Z-Factor: |
-1.69983 |
| Fitness Defect: |
8.9739 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 4|A9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-05-21 YYYY-MM-DD | | Plate CH Control (+): | 0.047825000000000006±0.00089 | | Plate DMSO Control (-): | 0.7141500000000001±0.04705 | | Plate Z-Factor: | 0.6652 |
| png ps pdf |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 4981 | Additional Members: 6 | Rows returned: 1 | |
|