| Compound Information | SONAR Target prediction | | Name: | Cantharidin | | Unique Identifier: | LOPAC 00793 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H12O4 | | Molecular Weight: | 184.105 g/mol | | X log p: | -1.539 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 52.6 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC12C3CCC(O3)C1(C)C(=O)OC2=O | | Class: | Phosphorylation | | Action: | Inhibitor | | Selectivity: | PP2A |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.6715±0.0244297 |
| Normalized OD Score: sc h |
0.8839±0.0562875 |
| Z-Score: |
-4.9221±1.04281 |
| p-Value: |
0.000000983942 |
| Z-Factor: |
-2.28061 |
| Fitness Defect: |
13.8317 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 4|A9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.60 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04620624999999999±0.00241 | | Plate DMSO Control (-): | 0.7474874999999999±0.05282 | | Plate Z-Factor: | 0.8689 |
| png ps pdf |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 4981 | Additional Members: 6 | Rows returned: 1 | |
|