Compound Information | SONAR Target prediction | Name: | Cyproterone acetate | Unique Identifier: | LOPAC 00767 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C24ClH29O4 | Molecular Weight: | 390.731 g/mol | X log p: | 3.24 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1(CCC2C3C=C(Cl)C4=CC(=O)C5CC5C4(C)C3CCC21C)C(C)=O | Class: | Hormone | Action: | Antagonist | Selectivity: | Androgen |
Species: |
4932 |
Condition: |
DEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6393±0.00813173 |
Normalized OD Score: sc h |
0.9913±0.000482594 |
Z-Score: |
-0.3574±0.0358885 |
p-Value: |
0.720886 |
Z-Factor: |
-6.38499 |
Fitness Defect: |
0.3273 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 4|G2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-11-16 YYYY-MM-DD | Plate CH Control (+): | 0.039125±0.00135 | Plate DMSO Control (-): | 0.628025±0.00914 | Plate Z-Factor: | 0.9378 |
| png ps pdf |
2714 |
(17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-y l) acetate |
2914 |
n/a |
9324 |
[(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclo penta[a]phenanthren-17-yl] acetate |
9875 |
[(9S,14S,16R,17R)-17-acetyl-6-chloro-10,13,16-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopen ta[a]phenanthren-17-yl] acetate |
9880 |
n/a |
31125 |
[(17R)-17-acetyl-6-chloro-13-methyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17 -yl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5652 | Additional Members: 7 | Rows returned: 2 | |
|