| Compound Information | SONAR Target prediction | | Name: | Cyproterone acetate | | Unique Identifier: | LOPAC 00767 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24ClH29O4 | | Molecular Weight: | 390.731 g/mol | | X log p: | 3.24 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1(CCC2C3C=C(Cl)C4=CC(=O)C5CC5C4(C)C3CCC21C)C(C)=O | | Class: | Hormone | | Action: | Antagonist | | Selectivity: | Androgen |
| Species: |
4932 |
| Condition: |
SMI1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6893±0.02786 |
| Normalized OD Score: sc h |
0.9826±0.00446661 |
| Z-Score: |
-0.4810±0.160235 |
| p-Value: |
0.63273 |
| Z-Factor: |
-2.67754 |
| Fitness Defect: |
0.4577 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 4|G2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.10 Celcius | | Date: | 2005-11-15 YYYY-MM-DD | | Plate CH Control (+): | 0.038599999999999995±0.00151 | | Plate DMSO Control (-): | 0.687325±0.01024 | | Plate Z-Factor: | 0.9563 |
|  png
ps
pdf |
| 2714 |
(17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-y
l) acetate |
| 2914 |
n/a |
| 9324 |
[(8R,9S,10R,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclo
penta[a]phenanthren-17-yl] acetate |
| 9875 |
[(9S,14S,16R,17R)-17-acetyl-6-chloro-10,13,16-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopen
ta[a]phenanthren-17-yl] acetate |
| 9880 |
n/a |
| 31125 |
[(17R)-17-acetyl-6-chloro-13-methyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17
-yl] acetate |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 5652 | Additional Members: 7 | Rows returned: 5 | |
|
