| Compound Information | SONAR Target prediction | | Name: | Cyproterone acetate | | Unique Identifier: | LOPAC 00767 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24ClH29O4 | | Molecular Weight: | 390.731 g/mol | | X log p: | 3.24 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1(CCC2C3C=C(Cl)C4=CC(=O)C5CC5C4(C)C3CCC21C)C(C)=O | | Class: | Hormone | | Action: | Antagonist | | Selectivity: | Androgen |
| Species: |
4932 |
| Condition: |
CIN2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8406±0.00424264 |
| Normalized OD Score: sc h |
1.0045±0.00503281 |
| Z-Score: |
0.3595±0.416805 |
| p-Value: |
0.730634 |
| Z-Factor: |
-65.3646 |
| Fitness Defect: |
0.3138 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 4|G2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2005-12-07 YYYY-MM-DD | | Plate CH Control (+): | 0.039025000000000004±0.00114 | | Plate DMSO Control (-): | 0.8283499999999999±0.01004 | | Plate Z-Factor: | 0.9451 |
| png ps pdf |
| 115058 |
[(8R,9S,10R,13S,14S)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopent a[a]phenanthren-17-yl] acetate |
| 3034800 |
n/a |
| 5702030 |
n/a |
| 6546958 |
[(8R,9R,10R,13R,14S,17S)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclo penta[a]phenanthren-17-yl] acetate |
| 6603774 |
n/a |
| 6710779 |
[(10R,13S,17R)-17-acetyl-6-chloro-10,13-dimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]ph enanthren-17-yl] acetate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5652 | Additional Members: 7 | Rows returned: 2 | |
|