Compound Information | SONAR Target prediction | Name: | Cortisone 21-acetate | Unique Identifier: | LOPAC 00764 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C23H30O6 | Molecular Weight: | 375.266 g/mol | X log p: | -0.673 (online calculus) | Lipinksi Failures | 0 | TPSA | 77.51 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(=O)CC21C | Class: | Hormone | Selectivity: | Cortisol |
Species: |
4932 |
Condition: |
SMI1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7043±0.0182434 |
Normalized OD Score: sc h |
1.0063±0.00942653 |
Z-Score: |
0.1831±0.272013 |
p-Value: |
0.84998 |
Z-Factor: |
-8.39539 |
Fitness Defect: |
0.1625 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 4|D2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2005-11-15 YYYY-MM-DD | Plate CH Control (+): | 0.038599999999999995±0.00151 | Plate DMSO Control (-): | 0.687325±0.01024 | Plate Z-Factor: | 0.9563 |
| png ps pdf |
7059631 |
[2-[(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7067809 |
[2-[(8S,9R,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7067810 |
[2-[(8S,9R,10R,13S,14R,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7067811 |
[2-[(8S,9S,10R,13S,14R,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclop enta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 11390 | Additional Members: 8 | Rows returned: 0 | |
|