Compound Information | SONAR Target prediction | Name: | Corticosterone | Unique Identifier: | LOPAC 00759 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H30O4 | Molecular Weight: | 319.246 g/mol | X log p: | 0.527 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC12CC(O)C3C(CCC4=CC(=O)CCC34C)C1CCC2C(=O)CO | Class: | Hormone | Selectivity: | Glucocorticoid |
Species: |
4932 |
Condition: |
GIM3 |
Replicates: |
4 |
Raw OD Value: r im |
0.5797±0.108472 |
Normalized OD Score: sc h |
1.0113±0.211399 |
Z-Score: |
0.2667±3.26885 |
p-Value: |
0.790946 |
Z-Factor: |
-4.59563 |
Fitness Defect: |
0.2345 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 3|F11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.50 Celcius | Date: | 2005-04-08 YYYY-MM-DD | Plate CH Control (+): | 0.04536250000000001±0.00326 | Plate DMSO Control (-): | 0.687175±0.17262 | Plate Z-Factor: | -0.1671 |
| png ps pdf |
5753 |
(8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17 -dodecahydrocyclopenta[a]phenanthren-3-one |
165276 |
(8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dod ecahydro-1H-cyclopenta[a]phenanthren-3-one |
256277 |
(8S,9S,10R,11R,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17 -dodecahydrocyclopenta[a]phenanthren-3-one |
439739 |
11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phe nanthren-3-one |
439858 |
(8S,9S,10R,13R,14S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecah ydrocyclopenta[a]phenanthren-3-one |
534502 |
11-hydroxy-17-(2-hydroxyacetyl)-9,10,13-trimethyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]ph enanthren-3-one |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 10196 | Additional Members: 12 | Rows returned: 0 | |
|