| Compound Information | SONAR Target prediction | | Name: | Corticosterone | | Unique Identifier: | LOPAC 00759 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H30O4 | | Molecular Weight: | 319.246 g/mol | | X log p: | 0.527 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC12CC(O)C3C(CCC4=CC(=O)CCC34C)C1CCC2C(=O)CO | | Class: | Hormone | | Selectivity: | Glucocorticoid |
| Species: |
4932 |
| Condition: |
PAC10 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7798±0.0039598 |
| Normalized OD Score: sc h |
0.9999±0.000650979 |
| Z-Score: |
-0.0047±0.0296609 |
| p-Value: |
0.983268 |
| Z-Factor: |
-6.36572 |
| Fitness Defect: |
0.0169 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 3|F11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.50 Celcius | | Date: | 2005-04-15 YYYY-MM-DD | | Plate CH Control (+): | 0.0446±0.00079 | | Plate DMSO Control (-): | 0.7522500000000001±0.07561 | | Plate Z-Factor: | 0.7626 |
| png ps pdf |
| 5753 |
(8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17 -dodecahydrocyclopenta[a]phenanthren-3-one |
| 165276 |
(8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dod ecahydro-1H-cyclopenta[a]phenanthren-3-one |
| 256277 |
(8S,9S,10R,11R,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17 -dodecahydrocyclopenta[a]phenanthren-3-one |
| 439739 |
11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phe nanthren-3-one |
| 439858 |
(8S,9S,10R,13R,14S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecah ydrocyclopenta[a]phenanthren-3-one |
| 534502 |
11-hydroxy-17-(2-hydroxyacetyl)-9,10,13-trimethyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]ph enanthren-3-one |
| internal high similarity DBLink | Rows returned: 6 | |
|