| Compound Information | SONAR Target prediction | | Name: | Chlorprothixene hydrochloride | | Unique Identifier: | LOPAC 00755 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C18Cl2H19NS | | Molecular Weight: | 333.171 g/mol | | X log p: | 17.85 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 28.54 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | Cl.CN(C)CCC=C1c2ccccc2Sc2cc(Cl)ccc21 | | Class: | Dopamine | | Action: | Antagonist | | Selectivity: | DRD2 |
| Species: |
4932 |
| Condition: |
NUM1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6781±0.033729 |
| Normalized OD Score: sc h |
0.9203±0.0113635 |
| Z-Score: |
-4.9275±1.16698 |
| p-Value: |
0.0000204548 |
| Z-Factor: |
-0.116854 |
| Fitness Defect: |
10.7973 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 3|A11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2005-11-30 YYYY-MM-DD | | Plate CH Control (+): | 0.038349999999999995±0.00048 | | Plate DMSO Control (-): | 0.733425±0.01259 | | Plate Z-Factor: | 0.9423 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6603768 |
(3E)-3-(3-chlorothioxanthen-9-ylidene)-N,N-dimethyl-propan-1-amine |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 11809 | Additional Members: 3 | Rows returned: 1 | |
|
