| Compound Information | SONAR Target prediction | | Name: | Chlorprothixene hydrochloride | | Unique Identifier: | LOPAC 00755 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C18Cl2H19NS | | Molecular Weight: | 333.171 g/mol | | X log p: | 17.85 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 28.54 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | Cl.CN(C)CCC=C1c2ccccc2Sc2cc(Cl)ccc21 | | Class: | Dopamine | | Action: | Antagonist | | Selectivity: | DRD2 |
| Species: |
4932 |
| Condition: |
LGE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3986±0.0132229 |
| Normalized OD Score: sc h |
0.8699±0.00921775 |
| Z-Score: |
-4.4705±0.446997 |
| p-Value: |
0.0000171562 |
| Z-Factor: |
0.395158 |
| Fitness Defect: |
10.9732 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 3|A11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.30 Celcius | | Date: | 2005-11-29 YYYY-MM-DD | | Plate CH Control (+): | 0.038475±0.00058 | | Plate DMSO Control (-): | 0.47057499999999997±0.00752 | | Plate Z-Factor: | 0.9284 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 6603768 |
(3E)-3-(3-chlorothioxanthen-9-ylidene)-N,N-dimethyl-propan-1-amine |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 11809 | Additional Members: 3 | Rows returned: 2 | |
|