Compound Information | SONAR Target prediction | Name: | Chlorprothixene hydrochloride | Unique Identifier: | LOPAC 00755 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18Cl2H19NS | Molecular Weight: | 333.171 g/mol | X log p: | 17.85 (online calculus) | Lipinksi Failures | 1 | TPSA | 28.54 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 3 | Canonical Smiles: | Cl.CN(C)CCC=C1c2ccccc2Sc2cc(Cl)ccc21 | Class: | Dopamine | Action: | Antagonist | Selectivity: | DRD2 |
Species: |
4932 |
Condition: |
WHI5 |
Replicates: |
2 |
Raw OD Value: r im |
0.5193±0.0555786 |
Normalized OD Score: sc h |
0.8401±0.0759555 |
Z-Score: |
-4.9716±2.87777 |
p-Value: |
0.00165844 |
Z-Factor: |
-11.4861 |
Fitness Defect: |
6.4019 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 3|A11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-20 YYYY-MM-DD | Plate CH Control (+): | 0.045825000000000005±0.00080 | Plate DMSO Control (-): | 0.701225±0.13565 | Plate Z-Factor: | 0.2500 |
| png ps pdf |
DBLink | Rows returned: 1 | |
6603768 |
(3E)-3-(3-chlorothioxanthen-9-ylidene)-N,N-dimethyl-propan-1-amine |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 11809 | Additional Members: 3 | Rows returned: 1 | |
|