| 
 | Compound Information | SONAR Target prediction |  | Name: | Beclomethasone |  | Unique Identifier: | LOPAC 00703 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C22ClH29O5 |  | Molecular Weight: | 379.685 g/mol |  | X log p: | 4.142  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(Cl)C(O)CC2(C)C1(O)C(=O)CO |  | Class: | Hormone |  | Selectivity: | Glucocorticoid | 
 
 
	
		| Species: | 4932 |  
		| Condition: | TEP1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5629±0.000282843 |  
		| Normalized OD Score: sc h | 0.9787±0.018669 |  
		| Z-Score: | -0.7900±0.608002 |  
		| p-Value: | 0.470664 |  
		| Z-Factor: | -12.2182 |  
		| Fitness Defect: | 0.7536 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 2|H10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2005-05-17 YYYY-MM-DD |  | Plate CH Control (+): | 0.0448±0.00128 |  | Plate DMSO Control (-): | 0.5727500000000001±0.02212 |  | Plate Z-Factor: | 0.8269 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 3 |  | 
 
	
		| 2308 | 9-chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopent a[a]phenanthren-3-one
 |  
		| 20469 | (8S,9R,10S,11S,13S,14S,16S,17R)-9-chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
		| 6603734 | (8R,9S,10S,11S,13R,14R,16R,17R)-9-chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
 |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 
 |