Compound Information | SONAR Target prediction | Name: | Beclomethasone | Unique Identifier: | LOPAC 00703 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22ClH29O5 | Molecular Weight: | 379.685 g/mol | X log p: | 4.142 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(Cl)C(O)CC2(C)C1(O)C(=O)CO | Class: | Hormone | Selectivity: | Glucocorticoid |
Species: |
4932 |
Condition: |
KRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6236±0.0301227 |
Normalized OD Score: sc h |
1.0059±0.0235783 |
Z-Score: |
0.2361±0.998175 |
p-Value: |
0.492396 |
Z-Factor: |
-7.27121 |
Fitness Defect: |
0.7085 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 2|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.80 Celcius | Date: | 2005-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.03905±0.00134 | Plate DMSO Control (-): | 0.6374500000000001±0.01660 | Plate Z-Factor: | 0.9651 |
| png ps pdf |
DBLink | Rows returned: 3 | |
2308 |
9-chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopent a[a]phenanthren-3-one |
20469 |
(8S,9R,10S,11S,13S,14S,16S,17R)-9-chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
6603734 |
(8R,9S,10S,11S,13R,14R,16R,17R)-9-chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,1 1,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 9739 | Additional Members: 15 | Rows returned: 1 | |
|