Compound Information | SONAR Target prediction | Name: | Adenosine 3`,5`-cyclic monophosphate | Unique Identifier: | LOPAC 00694 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H12N5O6P | Molecular Weight: | 317.111 g/mol | X log p: | 1.654 (online calculus) | Lipinksi Failures | 1 | TPSA | 94.89 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 11 | Rotatable Bond Count: | 1 | Canonical Smiles: | Nc1ncnc2n(cnc12)C1OC2COP(O)(=O)OC2C1O | Class: | Phosphorylation | Action: | Activator | Selectivity: | PKA | Generic_name: | CYCLIC AMP; CAMP | Chemical_iupac_name: | ADENOSINE-3-,5--CYCLIC-MONOPHOSPHATE | Drug_type: | Experimental | Drugbank_id: | EXPT00959 | Logp: | -0.53 +/- 0.57 | Drug_category: | Adenylate Cyclase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
8 |
Raw OD Value: r im |
0.8496±0.12447 |
Normalized OD Score: sc h |
0.9914±0.0373562 |
Z-Score: |
-0.1576±1.42539 |
p-Value: |
0.295028 |
Z-Factor: |
-19.6143 |
Fitness Defect: |
1.2207 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 2|A5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.60 Celcius | Date: | 2005-04-07 YYYY-MM-DD | Plate CH Control (+): | 0.046749999999999986±0.00334 | Plate DMSO Control (-): | 0.7916312500000005±0.04022 | Plate Z-Factor: | 0.8778 |
| png ps pdf |
274 |
8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
6076 |
(1R,6R,8R,9R)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
94231 |
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-[(2R,3R,4R,5R)-5-(6-aminopurin-9- yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-phosphinic acid |
216877 |
sodium (1R,6R,8R,9R)-8-(6-aminopurin-9-yl)-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
216878 |
(1R,6R,9R)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
260398 |
[5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-[5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymeth yl)oxolan-3-yl]oxy-phosphinic acid |
internal high similarity DBLink | Rows returned: 2 | |
nonactive | Cluster 725 | Additional Members: 3 | Rows returned: 2 | |
|