| Compound Information | SONAR Target prediction |  | Name: | Adenosine 3`,5`-cyclic monophosphate |  | Unique Identifier: | LOPAC 00694  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C10H12N5O6P |  | Molecular Weight: | 317.111 g/mol |  | X log p: | 1.654  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 94.89 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 11 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Nc1ncnc2n(cnc12)C1OC2COP(O)(=O)OC2C1O |  | Class: | Phosphorylation |  | Action: | Activator |  | Selectivity: | PKA |  | Generic_name: | CYCLIC AMP; CAMP |  | Chemical_iupac_name: | ADENOSINE-3-,5--CYCLIC-MONOPHOSPHATE |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT00959 |  | Logp: | -0.53 +/- 0.57 |  | Drug_category: | Adenylate Cyclase inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		CIN2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8270±0.0113844 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9860±0.000306058 | 
	 
	
		| Z-Score: | 
		-1.0650±0.0818491 | 
	 
	
		| p-Value: | 
		0.287688 | 
	 
	
		| Z-Factor: | 
		-2.14595 | 
	 
	
		| Fitness Defect: | 
		1.2459 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 2|A5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.00 Celcius |  | Date: | 2005-12-07 YYYY-MM-DD |  | Plate CH Control (+): | 0.0397±0.00133 |  | Plate DMSO Control (-): | 0.8148249999999999±0.01441 |  | Plate Z-Factor: | 0.9377 |  
  |  png ps pdf |  
 
 
	
		| 274 | 
		8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol | 
	 
	
		| 6076 | 
		(1R,6R,8R,9R)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol | 
	 
	
		| 94231 | 
		[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-[(2R,3R,4R,5R)-5-(6-aminopurin-9- yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-phosphinic acid | 
	 
	
		| 216877 | 
		sodium (1R,6R,8R,9R)-8-(6-aminopurin-9-yl)-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol | 
	 
	
		| 216878 | 
		(1R,6R,9R)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol | 
	 
	
		| 260398 | 
		[5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-[5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymeth yl)oxolan-3-yl]oxy-phosphinic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 2 |  |   
 |  nonactive | Cluster 725 | Additional Members: 3 | Rows returned: 2 |  |   
 
 |