Compound Information | SONAR Target prediction | Name: | Adenosine 3`,5`-cyclic monophosphate | Unique Identifier: | LOPAC 00694 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H12N5O6P | Molecular Weight: | 317.111 g/mol | X log p: | 1.654 (online calculus) | Lipinksi Failures | 1 | TPSA | 94.89 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 11 | Rotatable Bond Count: | 1 | Canonical Smiles: | Nc1ncnc2n(cnc12)C1OC2COP(O)(=O)OC2C1O | Class: | Phosphorylation | Action: | Activator | Selectivity: | PKA | Generic_name: | CYCLIC AMP; CAMP | Chemical_iupac_name: | ADENOSINE-3-,5--CYCLIC-MONOPHOSPHATE | Drug_type: | Experimental | Drugbank_id: | EXPT00959 | Logp: | -0.53 +/- 0.57 | Drug_category: | Adenylate Cyclase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
NOP16 |
Replicates: |
2 |
Raw OD Value: r im |
0.7445±0.00480833 |
Normalized OD Score: sc h |
1.0087±0.00267793 |
Z-Score: |
0.4012±0.0770921 |
p-Value: |
0.688744 |
Z-Factor: |
-3.57915 |
Fitness Defect: |
0.3729 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 2|A5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-22 YYYY-MM-DD | Plate CH Control (+): | 0.045450000000000004±0.00295 | Plate DMSO Control (-): | 0.695425±0.24016 | Plate Z-Factor: | -0.3853 |
| png ps pdf |
290479 |
8-(6-aminopurin-9-yl)-3-methoxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
3080770 |
(8R,9S)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
3246347 |
(1R,6S,8S,9R)-8-(6-aminopurin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
3246500 |
(1S,4S,6R,7R,8S)-8-(6-aminopurin-9-yl)-4-ethoxy-4-oxo-3,5,9-trioxa-4$l^{5}-phosphabicyclo[4.3.0]nonan-7- ol |
3554458 |
8-(6-aminopurin-9-yl)-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
4132952 |
8-(6-aminopurin-9-yl)-3-ethoxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-9-ol |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 725 | Additional Members: 3 | Rows returned: 0 | |
|