Compound Information | SONAR Target prediction | Name: | 4-Androsten-4-ol-3,17-dione | Unique Identifier: | LOPAC 00661 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C19H26O3 | Molecular Weight: | 276.202 g/mol | X log p: | -0.732 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC12CCC3C(CCC4=C(O)C(=O)CCC34C)C1CCC2=O | Class: | Hormone | Action: | Inhibitor | Selectivity: | Aromatase |
Species: |
4932 |
Condition: |
GAS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7270±0.0277186 |
Normalized OD Score: sc h |
1.0108±0.0172298 |
Z-Score: |
0.5194±0.826626 |
p-Value: |
0.608852 |
Z-Factor: |
-21.1264 |
Fitness Defect: |
0.4962 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 1|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.40 Celcius | Date: | 2005-11-17 YYYY-MM-DD | Plate CH Control (+): | 0.040175±0.00208 | Plate DMSO Control (-): | 0.757325±0.03496 | Plate Z-Factor: | 0.8199 |
| png ps pdf |
634045 |
4-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a] phenanthren-3-one |
6429883 |
(17R)-4,17-dihydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3 -one |
6432110 |
(17S)-4,17-dihydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3 -one |
6603709 |
(8R,9S,10S,13R,14R)-4-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanth rene-3,17-dione |
internal high similarity DBLink | Rows returned: 2 | |
nonactive | Cluster 17181 | Additional Members: 4 | Rows returned: 1 | |
|