Compound Information | SONAR Target prediction | Name: | 4-Androsten-4-ol-3,17-dione | Unique Identifier: | LOPAC 00661 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C19H26O3 | Molecular Weight: | 276.202 g/mol | X log p: | -0.732 (online calculus) | Lipinksi Failures | 0 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC12CCC3C(CCC4=C(O)C(=O)CCC34C)C1CCC2=O | Class: | Hormone | Action: | Inhibitor | Selectivity: | Aromatase |
Species: |
4932 |
Condition: |
KRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6721±0.0338704 |
Normalized OD Score: sc h |
1.0205±0.0428861 |
Z-Score: |
0.9076±1.86351 |
p-Value: |
0.353882 |
Z-Factor: |
-7.67903 |
Fitness Defect: |
1.0388 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 1|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.90 Celcius | Date: | 2005-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.0389±0.00106 | Plate DMSO Control (-): | 0.6550750000000001±0.01492 | Plate Z-Factor: | 0.9215 |
| png ps pdf |
160615 |
(8R,9S,10R,13S,14S,17S)-4,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopent a[a]phenanthren-3-one |
164714 |
(8S,9S,10R,13R,14S,17S)-17-acetyl-4-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-one |
253543 |
2-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-5,6,7,8,9,11,12,15,16,17-decahydrocyclopenta [a]phenanthren-3-one |
351707 |
4,17-dihydroxy-13,17-dimethyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
518960 |
4,17-dihydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
573196 |
9-hydroxyspiro[4.5]dec-8-en-10-one |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 17181 | Additional Members: 4 | Rows returned: 1 | |
|