| Compound Information | SONAR Target prediction |
| Name: | Amiprilose hydrochloride |
| Unique Identifier: | LOPAC 00658 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C14ClH28NO6 |
| Molecular Weight: | 313.606 g/mol |
| X log p: | -0.87 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 40.16 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 7 |
| Canonical Smiles: | Cl.CN(C)CCCOC1C(OC2OC(C)(C)OC21)C(O)CO |
| Class: | Immune System |
| Action: | Modulator |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [24] |
| Species: | 4932 |
| Condition: | SAP30 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8189±0.0205768 |
| Normalized OD Score: sc h | 1.0020±0.0128585 |
| Z-Score: | 0.2095±1.12092 |
| p-Value: | 0.438058 |
| Z-Factor: | -40.6919 |
| Fitness Defect: | 0.8254 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 12 | 1 2 Next >> |
| 2158 | 1-[4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
| 43261 | 1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol hydrochloride |
| 43262 | 1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-d iol |
| 121928 | (1R)-1-[(1R,3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane- 1,2-diol |
| 124163 | 3-[[(1R,3R,4S,5R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-4-y l]oxy]-N,N-dimethyl-propan-1-amine |
| 5702212 | 1-[(3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol hydrochloride |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01503083 | 1.0000 |
| active | Cluster 11451 | Additional Members: 4 | Rows returned: 1 |
| SPE01503083 | 0 |
Service provided by the
Mike Tyers Laboratory